ChemNet > CAS > 1131-09-5 Benzo[b]thiophene-3-acetic acid
1131-09-5 Benzo[b]thiophene-3-acetic acid
उत्पाद का नाम |
Benzo[b]thiophene-3-acetic acid |
समानार्थी |
Thianaphthene-3-acetic acid; 1-benzothiophen-3-ylacetic acid |
आणविक फार्मूला |
C10H8O2S |
आण्विक वजन |
192.2343 |
InChI |
InChI=1/C10H8O2S/c11-10(12)5-7-6-13-9-4-2-1-3-8(7)9/h1-4,6H,5H2,(H,11,12) |
कैस रजिस्टी संख्या |
1131-09-5 |
EINECS |
214-461-2 |
आणविक संरचना |
|
घनत्व |
1.368g/cm3 |
उबलने का समय |
378.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.688 |
फ्लैश प्वाइंट |
182.9°C |
खतरा प्रतीक |
|
खतरे के कोड |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|